C13H15ClF3NO — CID 63387590
N-(2-chloroethyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 63387590) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-(2-chloroethyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63387590 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(2-chloroethyl)-N-[[4-(trifluoromethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)Oc1ccc(CN(CCCl)C2CC2)cc1 |
| InChI | InChI=1S/C13H15ClF3NO/c14-7-8-18(11-3-4-11)9-10-1-5-12(6-2-10)19-13(15,16)17/h1-2,5-6,11H,3-4,7-9H2 |
| InChIKey | BDHJKSJSZFOAOX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|