C17H26ClN3O — CID 95901063
N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine (PubChem CID 95901063) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 95901063 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine |
| SMILES | CN(Cc1ccc(Cl)nc1)C1CCN(C[C@@H]2CCOC2)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-20(11-14-2-3-17(18)19-10-14)16-4-7-21(8-5-16)12-15-6-9-22-13-15/h2-3,10,15-16H,4-9,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | IAWNHYTVPQXJNI-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|