C11H18ClN5 — CID 142093151
2-[(6-chloro-3-pyridinyl)methyl]-1,4,5,6-tetrahydropyrimidin-5-amine;methanamine (PubChem CID 142093151) has the molecular formula C11H18ClN5 and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1,4,5,6-tetrahydropyrimidin-5-amine;methanamine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1,4,5,6-tetrahydropyrimidin-5-amine;methanamine |
|---|---|
| PubChem CID | 142093151 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1,4,5,6-tetrahydropyrimidin-5-amine;methanamine |
| SMILES | CN.NC1CN=C(Cc2ccc(Cl)nc2)NC1 |
| InChI | InChI=1S/C10H13ClN4.CH5N/c11-9-2-1-7(4-13-9)3-10-14-5-8(12)6-15-10;1-2/h1-2,4,8H,3,5-6,12H2,(H,14,15);2H2,1H3 |
| InChIKey | IEOAYFQDFQCSCV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|