C11H15ClN4O2 — CID 138394707
3-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine acetate (PubChem CID 138394707) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine acetate.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine acetate |
|---|---|
| PubChem CID | 138394707 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine acetate |
| SMILES | CC(=O)[O-].NC1=[N+](Cc2ccc(Cl)nc2)CCN1 |
| InChI | InChI=1S/C9H11ClN4.C2H4O2/c10-8-2-1-7(5-13-8)6-14-4-3-12-9(14)11;1-2(3)4/h1-2,5H,3-4,6H2,(H2,11,12);1H3,(H,3,4) |
| InChIKey | DOSXTTMHPRLNST-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|