C13H14BrClN2O2 — CID 23659648
(6-chloro-3-pyridinyl)methyl (1R,2S,4S)-2-bromo-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 23659648) has the molecular formula C13H14BrClN2O2 and a molecular weight of 345.62 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl (1R,2S,4S)-2-bromo-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | (6-chloro-3-pyridinyl)methyl (1R,2S,4S)-2-bromo-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 23659648 |
| Molecular Formula | C13H14BrClN2O2 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl (1R,2S,4S)-2-bromo-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)nc1)N1[C@H]2CC[C@@H]1[C@@H](Br)C2 |
| InChI | InChI=1S/C13H14BrClN2O2/c14-10-5-9-2-3-11(10)17(9)13(18)19-7-8-1-4-12(15)16-6-8/h1,4,6,9-11H,2-3,5,7H2/t9-,10-,11+/m0/s1 |
| InChIKey | PZYANBCPAKUEHV-GARJFASQSA-N |
| XLogP | 3.37 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|