C13H10ClF3N3O+ — CID 161147570
N-[1-[(6-chloro-3-pyridinyl)methyl]-3H-pyridin-1-ium-2-ylidene]-2,2,2-trifluoroacetamide (PubChem CID 161147570) has the molecular formula C13H10ClF3N3O+ and a molecular weight of 316.69 g/mol. Its IUPAC name is N-[1-[(6-chloro-3-pyridinyl)methyl]-3H-pyridin-1-ium-2-ylidene]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-3H-pyridin-1-ium-2-ylidene]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 161147570 |
| Molecular Formula | C13H10ClF3N3O+ |
| Molecular Weight | 316.69 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-3H-pyridin-1-ium-2-ylidene]-2,2,2-trifluoroacetamide |
| SMILES | O=C(/N=C1\CC=CC=[N+]1Cc1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N3O/c14-10-5-4-9(7-18-10)8-20-6-2-1-3-11(20)19-12(21)13(15,16)17/h1-2,4-7H,3,8H2/q+1/b19-11+ |
| InChIKey | AJMYWSYUHGGSIV-YBFXNURJSA-N |
| XLogP | 2.77 |
| TPSA | 45.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|