C8H10ClN3 — CID 22461898
N'-[(6-chloro-3-pyridinyl)methyl]ethanimidamide (PubChem CID 22461898) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]ethanimidamide.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 22461898 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]ethanimidamide |
| SMILES | C/C(N)=N\Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H10ClN3/c1-6(10)11-4-7-2-3-8(9)12-5-7/h2-3,5H,4H2,1H3,(H2,10,11) |
| InChIKey | QEVNMQJWLOYWOR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|