C15H17Cl2IN4 — CID 111131908
1-[(4-chlorophenyl)methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111131908) has the molecular formula C15H17Cl2IN4 and a molecular weight of 451.14 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111131908 |
| Molecular Formula | C15H17Cl2IN4 |
| Molecular Weight | 451.14 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCc1ccc(Cl)nc1.I |
| InChI | InChI=1S/C15H16Cl2N4.HI/c1-18-15(20-8-11-2-5-13(16)6-3-11)21-10-12-4-7-14(17)19-9-12;/h2-7,9H,8,10H2,1H3,(H2,18,20,21);1H |
| InChIKey | ZVLZBFPPXZWNHV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|