C18H24ClIN4O — CID 111131445
1-[(4-chlorophenyl)methyl]-2-methyl-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111131445) has the molecular formula C18H24ClIN4O and a molecular weight of 474.77 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111131445 |
| Molecular Formula | C18H24ClIN4O |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1)NCc1ccc(OC(C)C)nc1.I |
| InChI | InChI=1S/C18H23ClN4O.HI/c1-13(2)24-17-9-6-15(11-21-17)12-23-18(20-3)22-10-14-4-7-16(19)8-5-14;/h4-9,11,13H,10,12H2,1-3H3,(H2,20,22,23);1H |
| InChIKey | NOAUQJWMTFFUBT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|