C14H24N4OS — CID 111343707
2-methyl-1-(2-methylsulfanylethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine (PubChem CID 111343707) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111343707 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCCSC)NCc1ccc(OC(C)C)nc1 |
| InChI | InChI=1S/C14H24N4OS/c1-11(2)19-13-6-5-12(9-17-13)10-18-14(15-3)16-7-8-20-4/h5-6,9,11H,7-8,10H2,1-4H3,(H2,15,16,18) |
| InChIKey | PELWQUDGMBTMTB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|