C12H18ClN3S — CID 87549308
(2S)-2-amino-N-[(6-chloro-3-pyridinyl)methyl]-3-methylpentanethioamide (PubChem CID 87549308) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is (2S)-2-amino-N-[(6-chloro-3-pyridinyl)methyl]-3-methylpentanethioamide.
| Compound Name | (2S)-2-amino-N-[(6-chloro-3-pyridinyl)methyl]-3-methylpentanethioamide |
|---|---|
| PubChem CID | 87549308 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2S)-2-amino-N-[(6-chloro-3-pyridinyl)methyl]-3-methylpentanethioamide |
| SMILES | CCC(C)[C@H](N)C(=S)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H18ClN3S/c1-3-8(2)11(14)12(17)16-7-9-4-5-10(13)15-6-9/h4-6,8,11H,3,7,14H2,1-2H3,(H,16,17)/t8?,11-/m0/s1 |
| InChIKey | ZFZMVKIPMBTIOF-LYNSQETBSA-N |
| XLogP | 2.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|