C11H14ClI2N3 — CID 120655374
N-[(2-chloro-4-iodophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 120655374) has the molecular formula C11H14ClI2N3 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[(2-chloro-4-iodophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(2-chloro-4-iodophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120655374 |
| Molecular Formula | C11H14ClI2N3 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 476.90 |
| IUPAC Name | N-[(2-chloro-4-iodophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Clc1cc(I)ccc1CNC1=NCCCN1.I |
| InChI | InChI=1S/C11H13ClIN3.HI/c12-10-6-9(13)3-2-8(10)7-16-11-14-4-1-5-15-11;/h2-3,6H,1,4-5,7H2,(H2,14,15,16);1H |
| InChIKey | PAGRDLUPFCBYCZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|