C13H20IN3O2S — CID 119148482
N-[[2-(methylsulfonylmethyl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 119148482) has the molecular formula C13H20IN3O2S and a molecular weight of 409.29 g/mol. Its IUPAC name is N-[[2-(methylsulfonylmethyl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[2-(methylsulfonylmethyl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 119148482 |
| Molecular Formula | C13H20IN3O2S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[[2-(methylsulfonylmethyl)phenyl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CS(=O)(=O)Cc1ccccc1CNC1=NCCCN1.I |
| InChI | InChI=1S/C13H19N3O2S.HI/c1-19(17,18)10-12-6-3-2-5-11(12)9-16-13-14-7-4-8-15-13;/h2-3,5-6H,4,7-10H2,1H3,(H2,14,15,16);1H |
| InChIKey | RZSXTOANFDFQQY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|