C13H17Cl2N3 — CID 111549402
N-[3-(2,4-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 111549402) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[3-(2,4-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 111549402 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[3-(2,4-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Clc1ccc(CCCNC2=NCCCN2)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3/c14-11-5-4-10(12(15)9-11)3-1-6-16-13-17-7-2-8-18-13/h4-5,9H,1-3,6-8H2,(H2,16,17,18) |
| InChIKey | ZCFRMNBIAJXMAW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|