C14H12Cl2N4 — CID 133342192
3-[3-(2,4-dichlorophenyl)propylamino]pyrazine-2-carbonitrile (PubChem CID 133342192) has the molecular formula C14H12Cl2N4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenyl)propylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-(2,4-dichlorophenyl)propylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133342192 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[3-(2,4-dichlorophenyl)propylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4/c15-11-4-3-10(12(16)8-11)2-1-5-19-14-13(9-17)18-6-7-20-14/h3-4,6-8H,1-2,5H2,(H,19,20) |
| InChIKey | MOAUJZUJNVBTBM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|