C14H12Cl2N4O — CID 133284498
3-[3-(2,4-dichlorophenoxy)propylamino]pyrazine-2-carbonitrile (PubChem CID 133284498) has the molecular formula C14H12Cl2N4O and a molecular weight of 323.18 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenoxy)propylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-(2,4-dichlorophenoxy)propylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284498 |
| Molecular Formula | C14H12Cl2N4O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[3-(2,4-dichlorophenoxy)propylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4O/c15-10-2-3-13(11(16)8-10)21-7-1-4-19-14-12(9-17)18-5-6-20-14/h2-3,5-6,8H,1,4,7H2,(H,19,20) |
| InChIKey | FZEORYQSHXTZCT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|