C14H11Cl2N3 — CID 26472030
2-[2-(2,4-dichlorophenyl)ethylamino]pyridine-3-carbonitrile (PubChem CID 26472030) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 26472030 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3/c15-12-4-3-10(13(16)8-12)5-7-19-14-11(9-17)2-1-6-18-14/h1-4,6,8H,5,7H2,(H,18,19) |
| InChIKey | GLGDCNPJGCQQKE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |