C15H11Cl3N2 — CID 63511428
3-chloro-4-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile (PubChem CID 63511428) has the molecular formula C15H11Cl3N2 and a molecular weight of 325.63 g/mol. Its IUPAC name is 3-chloro-4-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile.
| Compound Name | 3-chloro-4-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 63511428 |
| Molecular Formula | C15H11Cl3N2 |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-chloro-4-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2/c16-12-3-2-11(13(17)8-12)5-6-20-15-4-1-10(9-19)7-14(15)18/h1-4,7-8,20H,5-6H2 |
| InChIKey | OVJWWBZGLXTPAY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |