C15H13Cl2N3 — CID 104711386
4-amino-3-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile (PubChem CID 104711386) has the molecular formula C15H13Cl2N3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 4-amino-3-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile.
| Compound Name | 4-amino-3-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 104711386 |
| Molecular Formula | C15H13Cl2N3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-amino-3-[2-(2,4-dichlorophenyl)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(N)c(NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3/c16-12-3-2-11(13(17)8-12)5-6-20-15-7-10(9-18)1-4-14(15)19/h1-4,7-8,20H,5-6,19H2 |
| InChIKey | XROZBFJTZWOXGA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|