C14H13BrCl2N2 — CID 28903733
4-bromo-1-N-[2-(2,4-dichlorophenyl)ethyl]benzene-1,2-diamine (PubChem CID 28903733) has the molecular formula C14H13BrCl2N2 and a molecular weight of 360.08 g/mol. Its IUPAC name is 4-bromo-1-N-[2-(2,4-dichlorophenyl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[2-(2,4-dichlorophenyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 28903733 |
| Molecular Formula | C14H13BrCl2N2 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4-bromo-1-N-[2-(2,4-dichlorophenyl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13BrCl2N2/c15-10-2-4-14(13(18)7-10)19-6-5-9-1-3-11(16)8-12(9)17/h1-4,7-8,19H,5-6,18H2 |
| InChIKey | XDZTVXVQRSVVTJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|