C12H13BrN2O — CID 61469654
4-bromo-1-N-[2-(furan-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 61469654) has the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. Its IUPAC name is 4-bromo-1-N-[2-(furan-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[2-(furan-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 61469654 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-bromo-1-N-[2-(furan-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1NCCc1ccco1 |
| InChI | InChI=1S/C12H13BrN2O/c13-9-3-4-12(11(14)8-9)15-6-5-10-2-1-7-16-10/h1-4,7-8,15H,5-6,14H2 |
| InChIKey | MMSYYWFEDODUIV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|