C8H11BrN2 — CID 11816737
4-bromo-1-N-ethylbenzene-1,2-diamine (PubChem CID 11816737) has the molecular formula C8H11BrN2 and a molecular weight of 215.09 g/mol. Its IUPAC name is 4-bromo-1-N-ethylbenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-ethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 11816737 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 4-bromo-1-N-ethylbenzene-1,2-diamine |
| SMILES | CCNc1ccc(Br)cc1N |
| InChI | InChI=1S/C8H11BrN2/c1-2-11-8-4-3-6(9)5-7(8)10/h3-5,11H,2,10H2,1H3 |
| InChIKey | FIHMWZLZKMUGJO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|