C13H15BrN2S — CID 115125536
4-bromo-1-N-[2-(3-methylthiophen-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 115125536) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 4-bromo-1-N-[2-(3-methylthiophen-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[2-(3-methylthiophen-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125536 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 4-bromo-1-N-[2-(3-methylthiophen-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Cc1ccsc1CCNc1ccc(Br)cc1N |
| InChI | InChI=1S/C13H15BrN2S/c1-9-5-7-17-13(9)4-6-16-12-3-2-10(14)8-11(12)15/h2-3,5,7-8,16H,4,6,15H2,1H3 |
| InChIKey | BIOAVKKMCQARDC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|