C13H12N4 — CID 60725697
2-(2-pyridin-3-ylethylamino)pyridine-3-carbonitrile (PubChem CID 60725697) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-(2-pyridin-3-ylethylamino)pyridine-3-carbonitrile.
| Compound Name | 2-(2-pyridin-3-ylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 60725697 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(2-pyridin-3-ylethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCCc1cccnc1 |
| InChI | InChI=1S/C13H12N4/c14-9-12-4-2-7-16-13(12)17-8-5-11-3-1-6-15-10-11/h1-4,6-7,10H,5,8H2,(H,16,17) |
| InChIKey | VAJWQEHEAGNXGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |