C15H15Cl2N3O2 — CID 133469039
4-[3-(2,4-dichlorophenoxy)propylamino]pyridine-3-carboxamide (PubChem CID 133469039) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenoxy)propylamino]pyridine-3-carboxamide.
| Compound Name | 4-[3-(2,4-dichlorophenoxy)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133469039 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-[3-(2,4-dichlorophenoxy)propylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-10-2-3-14(12(17)8-10)22-7-1-5-20-13-4-6-19-9-11(13)15(18)21/h2-4,6,8-9H,1,5,7H2,(H2,18,21)(H,19,20) |
| InChIKey | QWHUBSNZUGMBIG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|