C13H20N4O2 — CID 133455073
4-[2-(2,2-dimethylpropanoylamino)ethylamino]pyridine-3-carboxamide (PubChem CID 133455073) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpropanoylamino)ethylamino]pyridine-3-carboxamide.
| Compound Name | 4-[2-(2,2-dimethylpropanoylamino)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133455073 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-[2-(2,2-dimethylpropanoylamino)ethylamino]pyridine-3-carboxamide |
| SMILES | CC(C)(C)C(=O)NCCNc1ccncc1C(N)=O |
| InChI | InChI=1S/C13H20N4O2/c1-13(2,3)12(19)17-7-6-16-10-4-5-15-8-9(10)11(14)18/h4-5,8H,6-7H2,1-3H3,(H2,14,18)(H,15,16)(H,17,19) |
| InChIKey | DYYQYHRYMUTYAG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|