C12H18N4O2 — CID 133443007
4-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxamide (PubChem CID 133443007) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxamide.
| Compound Name | 4-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133443007 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxamide |
| SMILES | CN1CCOC(CNc2ccncc2C(N)=O)C1 |
| InChI | InChI=1S/C12H18N4O2/c1-16-4-5-18-9(8-16)6-15-11-2-3-14-7-10(11)12(13)17/h2-3,7,9H,4-6,8H2,1H3,(H2,13,17)(H,14,15) |
| InChIKey | LJPNPVLWYYTOHT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |