C17H15Cl2N5O2S — CID 133329073
6-[3-(2,4-dichlorophenoxy)propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 133329073) has the molecular formula C17H15Cl2N5O2S and a molecular weight of 424.31 g/mol. Its IUPAC name is 6-[3-(2,4-dichlorophenoxy)propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-[3-(2,4-dichlorophenoxy)propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133329073 |
| Molecular Formula | C17H15Cl2N5O2S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 6-[3-(2,4-dichlorophenoxy)propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1ccc(NCCCOc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C17H15Cl2N5O2S/c18-12-3-4-14(13(19)8-12)26-7-1-6-20-15-5-2-11(9-21-15)16(25)23-17-24-22-10-27-17/h2-5,8-10H,1,6-7H2,(H,20,21)(H,23,24,25) |
| InChIKey | QERUJHYGBAFBFB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|