C19H16FN7O2S — CID 133465099
6-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 133465099) has the molecular formula C19H16FN7O2S and a molecular weight of 425.45 g/mol. Its IUPAC name is 6-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133465099 |
| Molecular Formula | C19H16FN7O2S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 6-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1ccc(NCCCc2nc(-c3ccc(F)cc3)no2)nc1 |
| InChI | InChI=1S/C19H16FN7O2S/c20-14-6-3-12(4-7-14)17-24-16(29-27-17)2-1-9-21-15-8-5-13(10-22-15)18(28)25-19-26-23-11-30-19/h3-8,10-11H,1-2,9H2,(H,21,22)(H,25,26,28) |
| InChIKey | VAOWFNUMSLJKHZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|