C16H13F2N5O2S — CID 133329643
6-[2-(3,4-difluorophenoxy)ethylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 133329643) has the molecular formula C16H13F2N5O2S and a molecular weight of 377.38 g/mol. Its IUPAC name is 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133329643 |
| Molecular Formula | C16H13F2N5O2S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1ccc(NCCOc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C16H13F2N5O2S/c17-12-3-2-11(7-13(12)18)25-6-5-19-14-4-1-10(8-20-14)15(24)22-16-23-21-9-26-16/h1-4,7-9H,5-6H2,(H,19,20)(H,22,23,24) |
| InChIKey | HGRDDZFFRQMDNC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|