C17H19F2N3O3 — CID 155947426
6-[2-(3,4-difluorophenoxy)ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 155947426) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155947426 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 6-[2-(3,4-difluorophenoxy)ethylamino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NCCOc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C17H19F2N3O3/c1-24-8-6-21-17(23)12-2-5-16(22-11-12)20-7-9-25-13-3-4-14(18)15(19)10-13/h2-5,10-11H,6-9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | NONSVIWPECIPKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|