C17H17F2N3O3 — CID 56803329
4-[(carbamoylamino)methyl]-N-[2-(3,4-difluorophenoxy)ethyl]benzamide (PubChem CID 56803329) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-[2-(3,4-difluorophenoxy)ethyl]benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-[2-(3,4-difluorophenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 56803329 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-[2-(3,4-difluorophenoxy)ethyl]benzamide |
| SMILES | NC(=O)NCc1ccc(C(=O)NCCOc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H17F2N3O3/c18-14-6-5-13(9-15(14)19)25-8-7-21-16(23)12-3-1-11(2-4-12)10-22-17(20)24/h1-6,9H,7-8,10H2,(H,21,23)(H3,20,22,24) |
| InChIKey | YINFYAVYSRECSV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|