C16H13F2N5O2 — CID 56782452
N-[2-(3,4-difluorophenoxy)ethyl]-4-(2H-tetrazol-5-yl)benzamide (PubChem CID 56782452) has the molecular formula C16H13F2N5O2 and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-4-(2H-tetrazol-5-yl)benzamide.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-4-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 56782452 |
| Molecular Formula | C16H13F2N5O2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-4-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C16H13F2N5O2/c17-13-6-5-12(9-14(13)18)25-8-7-19-16(24)11-3-1-10(2-4-11)15-20-22-23-21-15/h1-6,9H,7-8H2,(H,19,24)(H,20,21,22,23) |
| InChIKey | UPPUFUYJMHPSJE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|