C12H9ClF2N2O2S — CID 56803293
4-chloro-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 56803293) has the molecular formula C12H9ClF2N2O2S and a molecular weight of 318.73 g/mol. Its IUPAC name is 4-chloro-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56803293 |
| Molecular Formula | C12H9ClF2N2O2S |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-chloro-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)c1scnc1Cl |
| InChI | InChI=1S/C12H9ClF2N2O2S/c13-11-10(20-6-17-11)12(18)16-3-4-19-7-1-2-8(14)9(15)5-7/h1-2,5-6H,3-4H2,(H,16,18) |
| InChIKey | WHQQGVVMZOUONE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|