C14H16ClF2N3O2S — CID 120631588
2-(2-aminoethyl)-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120631588) has the molecular formula C14H16ClF2N3O2S and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120631588 |
| Molecular Formula | C14H16ClF2N3O2S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(2-aminoethyl)-N-[2-(3,4-difluorophenoxy)ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCc1nc(C(=O)NCCOc2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C14H15F2N3O2S.ClH/c15-10-2-1-9(7-11(10)16)21-6-5-18-14(20)12-8-22-13(19-12)3-4-17;/h1-2,7-8H,3-6,17H2,(H,18,20);1H |
| InChIKey | OJEIRZBLCGEMBY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|