C16H21ClN4O3S — CID 120621811
2-(2-aminoethyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120621811) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120621811 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-(2-aminoethyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NCCNC(=O)c2csc(CCN)n2)cc1.Cl |
| InChI | InChI=1S/C16H20N4O3S.ClH/c1-23-12-4-2-11(3-5-12)15(21)18-8-9-19-16(22)13-10-24-14(20-13)6-7-17;/h2-5,10H,6-9,17H2,1H3,(H,18,21)(H,19,22);1H |
| InChIKey | HQPOXUXBOZZLJY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|