C17H18N6O3S — CID 133340031
6-[3-[(3-methylfuran-2-carbonyl)amino]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 133340031) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is 6-[3-[(3-methylfuran-2-carbonyl)amino]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-[3-[(3-methylfuran-2-carbonyl)amino]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133340031 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 6-[3-[(3-methylfuran-2-carbonyl)amino]propylamino]-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCCCNc1ccc(C(=O)Nc2nncs2)cn1 |
| InChI | InChI=1S/C17H18N6O3S/c1-11-5-8-26-14(11)16(25)19-7-2-6-18-13-4-3-12(9-20-13)15(24)22-17-23-21-10-27-17/h3-5,8-10H,2,6-7H2,1H3,(H,18,20)(H,19,25)(H,22,23,24) |
| InChIKey | DRBVUVAANMFHMW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|