C14H14N4O — CID 55133688
3-(3-phenoxypropylamino)pyrazine-2-carbonitrile (PubChem CID 55133688) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(3-phenoxypropylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(3-phenoxypropylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 55133688 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(3-phenoxypropylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCCOc1ccccc1 |
| InChI | InChI=1S/C14H14N4O/c15-11-13-14(18-9-8-16-13)17-7-4-10-19-12-5-2-1-3-6-12/h1-3,5-6,8-9H,4,7,10H2,(H,17,18) |
| InChIKey | ZCYXKVBJMYHGQX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|