C15H16N4O2 — CID 133284146
3-[3-(4-methoxyphenoxy)propylamino]pyrazine-2-carbonitrile (PubChem CID 133284146) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenoxy)propylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-(4-methoxyphenoxy)propylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284146 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[3-(4-methoxyphenoxy)propylamino]pyrazine-2-carbonitrile |
| SMILES | COc1ccc(OCCCNc2nccnc2C#N)cc1 |
| InChI | InChI=1S/C15H16N4O2/c1-20-12-3-5-13(6-4-12)21-10-2-7-18-15-14(11-16)17-8-9-19-15/h3-6,8-9H,2,7,10H2,1H3,(H,18,19) |
| InChIKey | IIBPXOPQZVUEFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|