C10H14N4O — CID 62673581
3-(4-methoxybutylamino)pyrazine-2-carbonitrile (PubChem CID 62673581) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-(4-methoxybutylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(4-methoxybutylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62673581 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-(4-methoxybutylamino)pyrazine-2-carbonitrile |
| SMILES | COCCCCNc1nccnc1C#N |
| InChI | InChI=1S/C10H14N4O/c1-15-7-3-2-4-13-10-9(8-11)12-5-6-14-10/h5-6H,2-4,7H2,1H3,(H,13,14) |
| InChIKey | JPBZXFCXPJHHBT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|