C10H12N4O2 — CID 115601436
N-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 115601436) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 115601436 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(CNC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N4O2/c15-14(16)9-3-1-8(2-4-9)7-13-10-11-5-6-12-10/h1-4H,5-7H2,(H2,11,12,13) |
| InChIKey | WVAYFRXPLQRVHL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|