C10H12ClN3O2 — CID 126477109
2-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 126477109) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride.
| Compound Name | 2-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 126477109 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H11N3O2.ClH/c14-13(15)9-3-1-8(2-4-9)7-10-11-5-6-12-10;/h1-4H,5-7H2,(H,11,12);1H |
| InChIKey | CZESHJXCKUQVCK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|