C10H14N2O3S2 — CID 18468865
2-benzyl-4,5-dihydro-1H-imidazole;sulfurothioic O-acid (PubChem CID 18468865) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1H-imidazole;sulfurothioic O-acid.
| Compound Name | 2-benzyl-4,5-dihydro-1H-imidazole;sulfurothioic O-acid |
|---|---|
| PubChem CID | 18468865 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-benzyl-4,5-dihydro-1H-imidazole;sulfurothioic O-acid |
| SMILES | O=S(O)(O)=S.c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2.H2O3S2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;1-5(2,3)4/h1-5H,6-8H2,(H,11,12);(H2,1,2,3,4) |
| InChIKey | QMDCXDBCXFANDN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |