C14H15F3N2O4S — CID 87180796
2-[(7-methyl-1-benzofuran-5-yl)methyl]-4,5-dihydro-1H-imidazole;trifluoromethanesulfonic acid (PubChem CID 87180796) has the molecular formula C14H15F3N2O4S and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-[(7-methyl-1-benzofuran-5-yl)methyl]-4,5-dihydro-1H-imidazole;trifluoromethanesulfonic acid.
| Compound Name | 2-[(7-methyl-1-benzofuran-5-yl)methyl]-4,5-dihydro-1H-imidazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87180796 |
| Molecular Formula | C14H15F3N2O4S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[(7-methyl-1-benzofuran-5-yl)methyl]-4,5-dihydro-1H-imidazole;trifluoromethanesulfonic acid |
| SMILES | Cc1cc(CC2=NCCN2)cc2ccoc12.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H14N2O.CHF3O3S/c1-9-6-10(8-12-14-3-4-15-12)7-11-2-5-16-13(9)11;2-1(3,4)8(5,6)7/h2,5-7H,3-4,8H2,1H3,(H,14,15);(H,5,6,7) |
| InChIKey | JMUGNOLQSZIGFG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|