C12H16N2 — CID 58951819
2-[(2,5-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 58951819) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 58951819 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | Cc1ccc(C)c(CC2=NCCN2)c1 |
| InChI | InChI=1S/C12H16N2/c1-9-3-4-10(2)11(7-9)8-12-13-5-6-14-12/h3-4,7H,5-6,8H2,1-2H3,(H,13,14) |
| InChIKey | GINRZYACXRCJPN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |