About 2-benzyl-4,5-dihydro-1H-imidazole;hydrate
2-benzyl-4,5-dihydro-1H-imidazole;hydrate (PubChem CID 174926458) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1H-imidazole;hydrate.
Molecular Properties
| Compound Name | 2-benzyl-4,5-dihydro-1H-imidazole;hydrate |
| PubChem CID | 174926458 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-benzyl-4,5-dihydro-1H-imidazole;hydrate |
| SMILES | O.c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2.H2O/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;/h1-5H,6-8H2,(H,11,12);1H2 |
| InChIKey | ITDQKWQQWIAMNL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-4,5-dihydro-1H-imidazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4,5-dihydro-1H-imidazole;hydrate?
The IUPAC name of 2-benzyl-4,5-dihydro-1H-imidazole;hydrate (CID 174926458) is 2-benzyl-4,5-dihydro-1H-imidazole;hydrate.
What is the SMILES notation for 2-benzyl-4,5-dihydro-1H-imidazole;hydrate?
The canonical SMILES for 2-benzyl-4,5-dihydro-1H-imidazole;hydrate is O.c1ccc(CC2=NCCN2)cc1.
What is the InChIKey of 2-benzyl-4,5-dihydro-1H-imidazole;hydrate?
The InChIKey is ITDQKWQQWIAMNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.H2O/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;/h1-5H,6-8H2,(H,11,12);1H2.
What are the key properties of 2-benzyl-4,5-dihydro-1H-imidazole;hydrate?
2-benzyl-4,5-dihydro-1H-imidazole;hydrate has a molecular weight of 178.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4,5-dihydro-1H-imidazole;hydrate is sourced from PubChem (CID 174926458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).