C10H14N2O — CID 174926458
2-benzyl-4,5-dihydro-1H-imidazole;hydrate (PubChem CID 174926458) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1H-imidazole;hydrate.
| Compound Name | 2-benzyl-4,5-dihydro-1H-imidazole;hydrate |
|---|---|
| PubChem CID | 174926458 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-benzyl-4,5-dihydro-1H-imidazole;hydrate |
| SMILES | O.c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2.H2O/c1-2-4-9(5-3-1)8-10-11-6-7-12-10;/h1-5H,6-8H2,(H,11,12);1H2 |
| InChIKey | ITDQKWQQWIAMNL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |