C13H20N2 — CID 145111115
ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole (PubChem CID 145111115) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole.
| Compound Name | ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 145111115 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC.c1ccc(CCC2=NCCN2)cc1 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11;1-2/h1-5H,6-9H2,(H,12,13);1-2H3 |
| InChIKey | VUTANLKWULIULC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |