About ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole
ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole (PubChem CID 145111115) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 145111115 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC.c1ccc(CCC2=NCCN2)cc1 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11;1-2/h1-5H,6-9H2,(H,12,13);1-2H3 |
| InChIKey | VUTANLKWULIULC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole (CID 145111115) is ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole is CC.c1ccc(CCC2=NCCN2)cc1.
What is the InChIKey of ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is VUTANLKWULIULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.C2H6/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11;1-2/h1-5H,6-9H2,(H,12,13);1-2H3.
What are the key properties of ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole?
ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 204.32 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-phenylethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 145111115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).