C17H18N2 — CID 11311265
2-[2-(2-phenylethyl)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 11311265) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-[2-(2-phenylethyl)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[2-(2-phenylethyl)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11311265 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[2-(2-phenylethyl)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(CCc2ccccc2C2=NCCN2)cc1 |
| InChI | InChI=1S/C17H18N2/c1-2-6-14(7-3-1)10-11-15-8-4-5-9-16(15)17-18-12-13-19-17/h1-9H,10-13H2,(H,18,19) |
| InChIKey | GHCKOGDITJNILQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |