C19H22N2O2 — CID 11536881
2-[2-[2-(2,5-dimethoxyphenyl)ethyl]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 11536881) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dimethoxyphenyl)ethyl]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[2-[2-(2,5-dimethoxyphenyl)ethyl]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11536881 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[2-[2-(2,5-dimethoxyphenyl)ethyl]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(OC)c(CCc2ccccc2C2=NCCN2)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-22-16-9-10-18(23-2)15(13-16)8-7-14-5-3-4-6-17(14)19-20-11-12-21-19/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H,20,21) |
| InChIKey | OEZCALSTPWOREM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |