C19H22N3O2S+ — CID 147484748
hydroxy-[4-methoxy-3-[[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]sulfanylmethyl]phenyl]-methylideneazanium (PubChem CID 147484748) has the molecular formula C19H22N3O2S+ and a molecular weight of 356.47 g/mol. Its IUPAC name is hydroxy-[4-methoxy-3-[[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]sulfanylmethyl]phenyl]-methylideneazanium.
| Compound Name | hydroxy-[4-methoxy-3-[[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]sulfanylmethyl]phenyl]-methylideneazanium |
|---|---|
| PubChem CID | 147484748 |
| Molecular Formula | C19H22N3O2S+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | hydroxy-[4-methoxy-3-[[2-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]sulfanylmethyl]phenyl]-methylideneazanium |
| SMILES | C=[N+](O)c1ccc(OC)c(CSc2ccccc2C2=NCCCN2)c1 |
| InChI | InChI=1S/C19H22N3O2S/c1-22(23)15-8-9-17(24-2)14(12-15)13-25-18-7-4-3-6-16(18)19-20-10-5-11-21-19/h3-4,6-9,12,23H,1,5,10-11,13H2,2H3,(H,20,21)/q+1 |
| InChIKey | FEIUGQIVGGDOMX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|